![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](backdrop1.jpg){kind=small}
![[IMG]](banner.jpg){kind=small}
![[IMG]](clearlogo.png){kind=small}
![[IMG]](fanart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Anywhere but Home (2004)/ | 2024-12-17 18:25 | - | |
| Anywhere but Home/ | 2025-09-25 21:40 | - | |
| Bring Me to Life/ | 2022-10-22 08:53 | - | |
| Call Me When You’re Sober/ | 2025-09-25 21:41 | - | |
| Call Me When You're Sober/ | 2025-01-22 04:02 | - | |
| Demos (2)/ | 2024-12-17 18:25 | - | |
| Demos 2001–2002/ | 2025-09-25 21:42 | - | |
| Demos 2001-2002/ | 2025-01-22 04:02 | - | |
| Evanescence/ | 2025-10-05 19:09 | - | |
| Everybody’s Fool/ | 2025-09-25 21:41 | - | |
| Everybody's Fool/ | 2025-01-22 04:03 | - | |
| Fallen (2003)/ | 2024-12-17 18:26 | - | |
| Fallen/ | 2025-09-25 21:41 | - | |
| Going Under/ | 2024-07-19 01:05 | - | |
| Good Enough/ | 2022-10-22 02:02 | - | |
| In the Shadows/ | 2024-12-17 18:26 | - | |
| Justice/ | 2025-09-25 21:41 | - | |
| Lithium/ | 2025-09-25 21:41 | - | |
| Lost Whispers (2016)/ | 2024-12-17 18:26 | - | |
| Lost Whispers/ | 2025-09-25 21:41 | - | |
| Lost in Paradise/ | 2022-10-22 02:02 | - | |
| My Heart Is Broken/ | 2022-10-22 02:02 | - | |
| My Immortal/ | 2024-07-19 01:05 | - | |
| Mystary EP/ | 2025-09-25 21:41 | - | |
| Not for Your Ears/ | 2025-09-25 21:41 | - | |
| Origin (2000)/ | 2024-12-17 18:30 | - | |
| Origin/ | 2025-09-25 21:41 | - | |
| Sound Asleep EP/ | 2022-10-22 02:02 | - | |
| Special 2004/ | 2022-10-22 02:01 | - | |
| Sweet Sacrifice/ | 2023-07-15 06:03 | - | |
| Synthesis (2017)/ | 2022-10-22 02:02 | - | |
| Synthesis/ | 2024-12-28 17:40 | - | |
| Synthesis Live (2018)/ | 2024-12-17 18:29 | - | |
| Synthesis Live/ | 2025-09-25 21:42 | - | |
| The Bitter Truth (2021)/ | 2024-12-17 18:29 | - | |
| The Bitter Truth/ | 2025-09-25 21:42 | - | |
| The Demos/ | 2022-10-22 02:01 | - | |
| The Open Door (2006)/ | 2024-12-17 18:30 | - | |
| The Open Door/ | 2025-09-25 21:42 | - | |
| The Other Side/ | 2024-12-17 18:25 | - | |
| The Ultimate Collection/ | 2025-09-25 21:42 | - | |
| Ultra Rare Trax, Vol. 3/ | 2024-12-17 18:35 | - | |
| Ultra Rare Trax Vol. 3/ | 2024-12-17 18:31 | - | |
| Unreleased, Live and Rare, Volume 3/ | 2022-10-22 02:02 | - | |
| What You Want/ | 2022-10-22 02:02 | - | |
| My immortal (DJ Gabriel's mix).mp3 | 2025-09-25 09:52 | 10M | |
| artist.nfo | 2026-01-11 09:14 | 9.5K | |
| backdrop1.jpg | 2024-10-06 18:43 | 74K | |
| banner.jpg | 2024-10-06 18:43 | 90K | |
| clearlogo.png | 2024-02-25 11:39 | 47K | |
| fanart.jpg | 2024-03-11 16:59 | 724K | |
| folder.jpg | 2024-10-06 18:43 | 139K | |
| logo.png | 2024-10-06 18:43 | 82K | |