![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cdart.png){kind=small}
![[IMG]](discart.png){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Into the Rainbow Vein.mp3 | 2025-09-25 16:27 | 1.7M | |
| 02 Chromakey Dreamcoat.mp3 | 2025-09-25 16:27 | 13M | |
| 03 Satellite Anthem Icarus.mp3 | 2025-09-25 16:27 | 14M | |
| 04 Peacock Tail.mp3 | 2025-09-25 16:27 | 12M | |
| 05 Dayvan Cowboy.flac | 2025-09-25 16:27 | 31M | |
| 05 Dayvan Cowboy.mp3 | 2025-09-25 16:27 | 12M | |
| 06 A Moment of Clarity.mp3 | 2025-09-25 16:27 | 2.0M | |
| 07 '84 Pontiac Dream.mp3 | 2025-09-25 16:27 | 8.8M | |
| 08 Sherbet Head.mp3 | 2025-09-25 16:27 | 6.2M | |
| 09 Oscar See Through Red Eye.mp3 | 2025-09-25 16:27 | 12M | |
| 10 Ataronchronon.mp3 | 2025-09-25 16:27 | 2.9M | |
| 11 Hey Saturday Sun.mp3 | 2025-09-25 16:27 | 11M | |
| 12 Constants Are Changing.mp3 | 2025-09-25 16:27 | 3.9M | |
| 13 Slow This Bird Down.mp3 | 2025-09-25 16:27 | 14M | |
| 14 Tears From the Compound Eye.mp3 | 2025-09-25 16:27 | 9.3M | |
| 15 Farewell Fire.mp3 | 2025-09-25 16:27 | 19M | |
| 16 Macquarie Ridge.mp3 | 2025-09-25 16:27 | 11M | |
| album.nfo | 2026-01-10 12:20 | 5.3K | |
| cdart.png | 2022-12-19 15:34 | 614K | |
| discart.png | 2022-06-03 09:00 | 614K | |
| folder.jpg | 2024-10-06 16:23 | 136K | |