![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](discart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 She's So Modern.flac | 2025-10-06 08:59 | 25M | |
| 03 Rat Trap.flac | 2025-10-06 08:59 | 36M | |
| 06 Someone's Looking at You.flac | 2025-10-06 08:59 | 35M | |
| 07 Joey's on the Street Again.flac | 2025-10-06 09:00 | 43M | |
| 08 Banana Republic.flac | 2025-10-06 08:59 | 25M | |
| 10 I Don't Like Mondays.flac | 2025-10-06 08:59 | 30M | |
| 11 Like Clockwork.flac | 2025-10-06 08:59 | 29M | |
| 12 The Boomtown Rats - Lookin' After No. 1.flac | 2025-10-06 08:59 | 25M | |
| 14 Never in a Million Years.flac | 2025-10-06 08:59 | 31M | |
| 15 Diamond Smiles.flac | 2025-10-06 08:59 | 31M | |
| 15 Mary of the 4th Form (single version).flac | 2025-10-06 09:01 | 31M | |
| 18 The Elephants Graveyard.flac | 2025-10-06 08:59 | 31M | |
| album.nfo | 2026-01-06 19:38 | 2.9K | |
| discart.jpg | 2023-07-15 11:39 | 244K | |
| folder.jpg | 2024-10-07 00:04 | 121K | |