![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Die Die Die.flac | 2025-10-06 09:41 | 29M | |
| 02 New Age Inc.flac | 2025-10-06 09:41 | 34M | |
| 03 Chemical Sky.flac | 2025-10-06 09:41 | 31M | |
| 04 Monsoon Song.flac | 2025-10-06 09:41 | 23M | |
| 05 The Escape Artist.flac | 2025-10-06 09:41 | 41M | |
| 06 Good Ol' Black Magic.flac | 2025-10-06 09:41 | 29M | |
| 07 Empire.flac | 2025-10-06 09:41 | 26M | |
| 08 The Surgeon and The Virgin.flac | 2025-10-06 09:41 | 34M | |
| 09 Beating Butterflies.flac | 2025-10-06 09:41 | 32M | |
| 10 Dead Eden.flac | 2025-10-06 09:41 | 30M | |
| album.nfo | 2025-10-25 06:45 | 3.1K | |
| folder.jpg | 2024-10-07 02:02 | 129K | |