![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[IMG]](discart.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2025-10-25 06:26 | 4.0K | |
| folder.jpg | 2024-10-07 04:41 | 59K | |
| discart.jpg | 2022-09-13 16:33 | 86K | |
| 1-05 Smiles.flac | 2025-10-06 09:51 | 12M | |
| 1-06 Step Into the Breeze.flac | 2025-10-06 09:51 | 15M | |
| 1-01 You Know It's True.flac | 2025-10-06 09:51 | 20M | |
| 1-03 I Want You.flac | 2025-10-06 09:51 | 25M | |
| 1-04 Run.flac | 2025-10-06 09:51 | 25M | |
| 1-07 Symphony Space.flac | 2025-10-06 09:51 | 26M | |
| 2-03 Angel Sigh.flac | 2025-10-06 09:51 | 28M | |
| 2-01 Take Your Time.flac | 2025-10-06 09:51 | 31M | |
| 1-02 If I Were With Her Now.flac | 2025-10-06 09:51 | 34M | |
| 2-05 200 Bars.flac | 2025-10-06 09:51 | 35M | |
| 2-04 Sway.flac | 2025-10-06 09:51 | 39M | |
| 2-02 Shine a Light.flac | 2025-10-06 09:51 | 41M | |