![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](logo.png){kind=logo}
![[IMG]](folder.jpg){kind=small}
![[IMG]](clearlogo.png){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-01-06 07:57 | 3.3K | |
| 15 A Permanent Solution to a Temporary Problem.flac | 2025-10-06 10:07 | 69M | |
| 14 This Glass House of Broken Words.flac | 2025-10-06 10:07 | 21M | |
| 13 Another Cheap Brand of Luck.flac | 2025-10-06 10:07 | 4.1M | |
| 12 They Lie to Hide the Truth.flac | 2025-10-06 10:07 | 37M | |
| 11 Paper Cut.flac | 2025-10-06 10:07 | 4.4M | |
| 10 Fingernails on a Chalkboard.flac | 2025-10-06 10:07 | 26M | |
| 09 Theory of Pride in Tragedy.flac | 2025-10-06 10:07 | 39M | |
| 08 Liquor & Cigarettes.flac | 2025-10-06 10:07 | 5.2M | |
| 07 Pretty Smiles & Shattered Teeth.flac | 2025-10-06 10:07 | 36M | |
| 06 Southern Spirit Suite.flac | 2025-10-06 10:07 | 3.6M | |
| 05 12 Oz. Prophet.flac | 2025-10-06 10:07 | 21M | |
| 04 Forgive & Regret.flac | 2025-10-06 10:07 | 18M | |
| 03 A Scream Trapped Underwater.flac | 2025-10-06 10:07 | 39M | |
| 02 Leaves of Three.flac | 2025-10-06 10:07 | 27M | |
| 01 Scarlet Sunrise.flac | 2025-10-06 10:07 | 6.6M | |
| logo.png | 2024-10-06 23:23 | 38K | |
| folder.jpg | 2024-06-17 14:49 | 114K | |
| clearlogo.png | 2024-02-25 11:53 | 92K | |