![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 The Plug-In Drug.mp3 | 2025-10-06 10:09 | 9.2M | |
| 02 Everything Is Under Control.mp3 | 2025-10-06 10:09 | 8.8M | |
| 03 Adolph's Library.mp3 | 2025-10-06 10:09 | 7.9M | |
| 04 Bleak Is My Favourite Chic.mp3 | 2025-10-06 10:09 | 7.7M | |
| 05 Otto Rahn.mp3 | 2025-10-06 10:09 | 16M | |
| 06 The Corporate Homoerotic Cyclists.mp3 | 2025-10-06 10:09 | 9.5M | |
| 07 The New Cocksucker Blues.mp3 | 2025-10-06 10:09 | 7.5M | |
| 08 Soul Invictus.mp3 | 2025-10-06 10:09 | 12M | |
| 09 21st Century Lullaby.mp3 | 2025-10-06 10:09 | 11M | |
| 10 Apocalypse Fatigue.mp3 | 2025-10-06 10:09 | 13M | |
| folder.jpg | 2025-10-25 05:46 | 98K | |
| album.nfo | 2026-01-06 15:59 | 2.3K | |