![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](discart.png){kind=small}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| discart.png | 2024-02-03 10:57 | 903K | |
| folder.jpg | 2024-10-07 01:27 | 64K | |
| 01 ...and the Forest Began to Sing.mp3 | 2025-10-06 11:16 | 4.2M | |
| 02 Tricky Two.mp3 | 2025-10-06 11:16 | 18M | |
| 03 The Alcoholic.mp3 | 2025-10-06 11:16 | 12M | |
| 04 Senior Living.mp3 | 2025-10-06 11:16 | 12M | |
| 05 The Drug.mp3 | 2025-10-06 11:16 | 14M | |
| 06 Forsaken Cowboy.mp3 | 2025-10-06 11:16 | 13M | |
| 07 The Fear.mp3 | 2025-10-06 11:16 | 16M | |
| 08 Coming Home.mp3 | 2025-10-06 11:16 | 12M | |
| 09 A Long, Long Way _ The Final Day.mp3 | 2025-10-06 11:16 | 28M | |
| album.nfo | 2026-01-07 18:06 | 3.1K | |