![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| folder.jpg | 2025-02-02 01:39 | 113K | |
| 01 The Next Big Thing.flac | 2025-10-06 17:52 | 29M | |
| 02 Run on Empty.flac | 2025-10-06 17:52 | 22M | |
| 03 Look Out Tomorrow.flac | 2025-10-06 17:52 | 26M | |
| 04 Top of the World.flac | 2025-10-06 17:52 | 24M | |
| 05 Rails.flac | 2025-10-06 17:52 | 22M | |
| 06 Wishing It Away.flac | 2025-10-06 17:52 | 32M | |
| 07 Chemical #1.flac | 2025-10-06 17:52 | 24M | |
| 08 Motion.flac | 2025-10-06 17:52 | 33M | |
| 09 They're Out There.flac | 2025-10-06 17:52 | 27M | |
| 10 For a Moment.flac | 2025-10-06 17:52 | 25M | |
| 11 Addiction, Obsessions and Me.flac | 2025-10-06 17:52 | 30M | |
| 12 February.flac | 2025-10-06 17:52 | 35M | |
| album.nfo | 2026-01-06 09:15 | 2.9K | |