![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| folder.jpg | 2025-02-02 05:31 | 133K | |
| album.nfo | 2026-01-07 19:21 | 2.3K | |
| 10 This World.flac | 2025-10-06 18:47 | 34M | |
| 09 Ghetto on Fire.flac | 2025-10-06 18:47 | 24M | |
| 08 Forwared Jah Jah Children.flac | 2025-10-06 18:47 | 24M | |
| 07 Tired Fe Lick Weed in a Bush.flac | 2025-10-06 18:46 | 17M | |
| 06 Groovin' in Love.flac | 2025-10-06 18:46 | 27M | |
| 05 Roman Soldiers of Babylon.flac | 2025-10-06 18:46 | 17M | |
| 04 Jah Music.flac | 2025-10-06 18:46 | 25M | |
| 03 Reggae Thing.flac | 2025-10-06 18:46 | 26M | |
| 02 80,000 Careless Ethiopians.flac | 2025-10-06 18:46 | 21M | |
| 01 Love Is the Drug.flac | 2025-10-06 18:46 | 28M | |