![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[IMG]](discart.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| folder.jpg | 2024-01-13 03:57 | 271K | |
| discart.jpg | 2024-01-13 03:57 | 67K | |
| album.nfo | 2025-10-24 14:48 | 2.7K | |
| 13 I've Seen That Face Before (Libertango).mp3 | 2025-10-06 19:50 | 10M | |
| 12 Walking in the Rain.mp3 | 2025-10-06 19:50 | 10M | |
| 11 My Jamaican Guy.mp3 | 2025-10-06 19:50 | 14M | |
| 10 La Vie en rose.mp3 | 2025-10-06 19:50 | 17M | |
| 09 Demolition Man.mp3 | 2025-10-06 19:50 | 9.4M | |
| 08 Breakdown.mp3 | 2025-10-06 19:50 | 13M | |
| 07 Nipple to the Bottle.mp3 | 2025-10-06 19:50 | 14M | |
| 06 Nightclubbing.mp3 | 2025-10-06 19:50 | 12M | |
| 05 Love Is the Drug.mp3 | 2025-10-06 19:50 | 20M | |
| 04 Pull Up to the Bumper.mp3 | 2025-10-06 19:50 | 11M | |
| 03 Warm Leatherette.mp3 | 2025-10-06 19:50 | 13M | |
| 02 Inspiration.mp3 | 2025-10-06 19:50 | 11M | |
| 01 Private Life.mp3 | 2025-10-06 19:50 | 15M | |