![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](discart.png){kind=small}
![[IMG]](cdart.png){kind=small}
![[IMG]](folder.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 08 The Twistinside.flac | 2025-10-06 21:09 | 34M | |
| 12 Pale Green Stars.flac | 2025-10-06 21:09 | 31M | |
| 05 Summerland.flac | 2025-10-06 21:09 | 28M | |
| 01 Electra Made Me Blind.flac | 2025-10-06 21:09 | 28M | |
| 14 My Sexual Life.flac | 2025-10-06 21:09 | 26M | |
| 04 Santa Monica.flac | 2025-10-06 21:09 | 22M | |
| 07 Heartspark Dollarsign.flac | 2025-10-06 21:09 | 21M | |
| 03 You Make Me Feel Like a Whore.flac | 2025-10-06 21:09 | 21M | |
| 11 Queen of the Air.flac | 2025-10-06 21:09 | 19M | |
| 02 Heroin Girl.flac | 2025-10-06 21:09 | 18M | |
| 06 Strawberry.flac | 2025-10-06 21:09 | 17M | |
| 09 Her Brand New Skin.flac | 2025-10-06 21:09 | 16M | |
| 13 Chemical Smile.flac | 2025-10-06 21:09 | 15M | |
| 10 Nehalem.flac | 2025-10-06 21:09 | 14M | |
| discart.png | 2023-11-22 01:17 | 958K | |
| cdart.png | 2023-01-16 04:38 | 958K | |
| folder.jpg | 2024-10-07 00:27 | 133K | |
| album.nfo | 2026-01-07 03:05 | 4.1K | |