![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2025-11-17 04:45 | 4.3K | |
| folder.jpg | 2024-10-07 03:12 | 136K | |
| 01 System....flac | 2025-10-06 21:20 | 37M | |
| 05 Arguing With Thermometers.flac | 2025-10-06 21:20 | 72M | |
| 03 Sssnakepit.flac | 2025-10-06 21:20 | 73M | |
| 02 ...Meltdown.flac | 2025-10-06 21:20 | 75M | |
| 10 Hello Tyrannosaurus, Meet Tyrannicide.flac | 2025-10-06 21:20 | 75M | |
| 04 Search Party.flac | 2025-10-06 21:20 | 80M | |
| 09 Pack of Thieves.flac | 2025-10-06 21:20 | 82M | |
| 06 Stalemate.flac | 2025-10-06 21:20 | 86M | |
| 07 Gandhi Mate, Gandhi.flac | 2025-10-06 21:20 | 88M | |
| 11 Constellations.flac | 2025-10-06 21:20 | 92M | |
| 08 Warm Smiles Do Not Make You Welcome Here.flac | 2025-10-06 21:20 | 95M | |