![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 15 Violet.flac | 2025-10-06 21:46 | 29M | |
| 14 Numb.flac | 2025-10-06 21:46 | 31M | |
| 13 Selfish.flac | 2025-10-06 21:46 | 35M | |
| 12 End of the World.flac | 2025-10-06 21:46 | 27M | |
| 11 X-Hale.flac | 2025-10-06 21:46 | 15M | |
| 10 Hypocrite.flac | 2025-10-06 21:46 | 25M | |
| 09 A New Low.flac | 2025-10-06 21:46 | 30M | |
| 08 Drug Music.flac | 2025-10-06 21:46 | 33M | |
| 07 Razorblade Butterfly.flac | 2025-10-06 21:46 | 27M | |
| 06 1999.flac | 2025-10-06 21:46 | 29M | |
| 05 Hold On.flac | 2025-10-06 21:46 | 27M | |
| 04 Lexipro.flac | 2025-10-06 21:46 | 8.9M | |
| 03 Shoulda Known Better.flac | 2025-10-06 21:46 | 27M | |
| 02 Blood Money.flac | 2025-10-06 21:46 | 36M | |
| 01 Intro_ Confessions of a Felon.flac | 2025-10-06 21:46 | 1.1M | |
| album.nfo | 2025-09-03 22:38 | 3.5K | |
| folder.jpg | 2024-10-07 02:52 | 242K | |