![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
![[IMG]](backdrop.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Dead Letter Circus (2018)/ | 2025-01-31 12:46 | - | |
| The Catalyst Fire (2013)/ | 2025-01-31 12:46 | - | |
| The Endless Mile/ | 2025-01-31 14:30 | - | |
| The Catalyst Fire/ | 2025-01-31 14:30 | - | |
| Aesthesis/ | 2025-02-02 08:30 | - | |
| Dead Letter Circus/ | 2025-10-06 22:11 | - | |
| album.nfo | 2024-07-18 19:17 | 748 | |
| folder.jpg | 2025-01-31 14:30 | 92K | |
| logo.png | 2025-01-31 14:30 | 33K | |
| backdrop.jpg | 2025-01-31 14:30 | 199K | |
| artist.nfo | 2025-11-16 21:32 | 1.7K | |