![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Smiles and Smiles to Go.flac | 2025-10-04 04:28 | 35M | |
| 02 Perfect Peace.flac | 2025-10-04 04:28 | 25M | |
| 03 Carrying You.flac | 2025-10-04 04:28 | 18M | |
| 04 The Lord's Prayer.flac | 2025-10-04 04:28 | 21M | |
| 05 High Steppin'.flac | 2025-10-04 04:28 | 31M | |
| 06 Whatever Happens.flac | 2025-10-04 04:28 | 24M | |
| 07 Pure Delight.flac | 2025-10-04 04:28 | 32M | |
| 08 Alone _ But Never Alone.flac | 2025-10-04 04:28 | 18M | |
| album.nfo | 2025-11-15 09:27 | 2.0K | |
| folder.jpg | 2025-08-24 18:58 | 88K | |