![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[IMG]](discart.png){kind=small}
![[IMG]](cdart.png){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| folder.jpg | 2024-10-06 23:35 | 100K | |
| discart.png | 2022-08-31 08:51 | 370K | |
| cdart.png | 2022-11-30 17:38 | 275K | |
| album.nfo | 2026-01-03 20:32 | 9.2K | |
| 15 Like a Drug.mp3 | 2025-10-04 01:52 | 7.5M | |
| 14 Long Slow Goodbye _ Hidden Finale.mp3 | 2025-10-04 01:52 | 16M | |
| 13 _You Got a Killer Scene There, Man..._.mp3 | 2025-10-04 01:52 | 11M | |
| 12 Broken Box.mp3 | 2025-10-04 01:52 | 7.0M | |
| 11 Skin on Skin.mp3 | 2025-10-04 01:52 | 8.5M | |
| 10 The Blood Is Love.mp3 | 2025-10-04 01:52 | 15M | |
| 09 Someone's in the Wolf.mp3 | 2025-10-04 01:52 | 17M | |
| 08 I Never Came.mp3 | 2025-10-04 01:52 | 11M | |
| 07 Little Sister.mp3 | 2025-10-04 01:52 | 6.7M | |
| 06 In My Head.mp3 | 2025-10-04 01:52 | 9.3M | |
| 05 Burn the Witch.mp3 | 2025-10-04 01:52 | 8.3M | |
| 04 Tangled Up in Plaid.mp3 | 2025-10-04 01:52 | 9.7M | |
| 03 Everybody Knows That You Are Insane.mp3 | 2025-10-04 01:52 | 9.8M | |
| 02 Medication.mp3 | 2025-10-04 01:52 | 4.4M | |
| 01 This Lullaby.mp3 | 2025-10-04 01:52 | 3.2M | |