![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](back.jpg){kind=small}
![[IMG]](front.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| - Thor (2018).txt | 2024-11-26 13:08 | 799 | |
| 01 Chasing the Storm.mp3 | 2025-10-02 13:54 | 7.4M | |
| 02 Prologue.mp3 | 2025-10-02 13:54 | 7.3M | |
| 03 Sons of Odin.mp3 | 2025-10-02 13:54 | 4.2M | |
| 04 A New King.mp3 | 2025-10-02 13:54 | 7.0M | |
| 05 Ride to Observatory.mp3 | 2025-10-02 13:54 | 5.0M | |
| 06 To Jotunheim.mp3 | 2025-10-02 13:54 | 5.4M | |
| 07 Laufey.mp3 | 2025-10-02 13:54 | 8.5M | |
| 08 Frost Giant Battle.mp3 | 2025-10-02 13:54 | 10M | |
| 09 Banishment.mp3 | 2025-10-02 13:54 | 4.4M | |
| 10 Crisis in Asgard.mp3 | 2025-10-02 13:54 | 5.4M | |
| 11 Odin Confesses.mp3 | 2025-10-02 13:54 | 6.3M | |
| 12 Hammer Found.mp3 | 2025-10-02 13:54 | 2.8M | |
| 13 Urgent Matter.mp3 | 2025-10-02 13:54 | 5.5M | |
| 14 The Compound.mp3 | 2025-10-02 13:54 | 18M | |
| 15 Loki's Lie.mp3 | 2025-10-02 13:54 | 4.4M | |
| 16 My Bastard Son.mp3 | 2025-10-02 13:54 | 6.1M | |
| 17 Science and Magic.mp3 | 2025-10-02 13:54 | 6.7M | |
| 18 The Destroyer.mp3 | 2025-10-02 13:54 | 6.8M | |
| 19 Forgive Me.mp3 | 2025-10-02 13:54 | 6.2M | |
| 20 Thor Kills the Destroyer.mp3 | 2025-10-02 13:54 | 4.4M | |
| 21 Brothers Fight.mp3 | 2025-10-02 13:54 | 16M | |
| 22 Letting Go.mp3 | 2025-10-02 13:54 | 7.6M | |
| 23 Can You See Jane_.mp3 | 2025-10-02 13:54 | 5.5M | |
| 24 Earth to Asgard.mp3 | 2025-10-02 13:54 | 5.9M | |
| album.nfo | 2026-01-01 00:08 | 3.9K | |
| back.jpg | 2024-11-26 13:08 | 97K | |
| front.jpg | 2024-11-26 13:08 | 58K | |