![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](00-nine_inch_nails-quake-ost-web-1996.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 00-nine_inch_nails-quake-ost-web-1996.jpg | 2025-02-11 09:37 | 298K | |
| 00-nine_inch_nails-quake-ost-web-1996.nfo | 2025-02-11 09:37 | 1.2K | |
| 1-01 Quake Theme.mp3 | 2025-10-02 13:56 | 12M | |
| 1-02 Aftermath.mp3 | 2025-10-02 13:56 | 5.6M | |
| 1-03 The Hall of Souls.mp3 | 2025-10-02 13:56 | 19M | |
| 1-04 It Is Raped.mp3 | 2025-10-02 13:56 | 14M | |
| 1-05 Parallel Dimensions.mp3 | 2025-10-02 13:56 | 17M | |
| 1-06 Life.mp3 | 2025-10-02 13:56 | 20M | |
| 2-01 Damnation.mp3 | 2025-10-02 13:56 | 13M | |
| 2-02 Focus.mp3 | 2025-10-02 13:56 | 15M | |
| 2-03 Falling.mp3 | 2025-10-02 13:56 | 8.2M | |
| 2-04 The Reaction.mp3 | 2025-10-02 13:56 | 12M | |
| album.nfo | 2026-01-01 00:43 | 2.2K | |